![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Leave Home.mp3 | 2023-09-10 14:56 | 5.1M | |
| 02 In Dust We Trust.mp3 | 2023-09-10 14:56 | 4.8M | |
| 03 Song to the Siren.mp3 | 2023-09-10 14:56 | 3.0M | |
| 04 Three Little Birdies Down Beats.mp3 | 2023-09-10 14:56 | 5.2M | |
| 05 Fuck Up Beats.mp3 | 2023-09-10 14:56 | 1.3M | |
| 06 Chemical Beats.mp3 | 2023-09-10 14:56 | 4.4M | |
| 07 Chico's Groove.mp3 | 2023-09-10 14:56 | 4.4M | |
| 08 One Too Many Mornings.mp3 | 2023-09-10 14:56 | 3.8M | |
| 09 Life Is Sweet.mp3 | 2023-09-10 14:57 | 6.0M | |
| 10 Playground for a Wedgeless Firm.mp3 | 2023-09-10 14:57 | 2.3M | |
| 11 Alive Alone.mp3 | 2023-09-10 14:57 | 4.8M | |
| AlbumArtSmall.jpg | 2016-05-24 23:34 | 2.4K | |
| AlbumArt_{53133EAF-99FE-4DF7-B0D3-6E9D6AE6C984}_Large.jpg | 2016-05-24 23:34 | 9.5K | |
| AlbumArt_{53133EAF-99FE-4DF7-B0D3-6E9D6AE6C984}_Small.jpg | 2016-05-24 23:34 | 2.4K | |
| Folder.jpg | 2016-05-24 23:34 | 9.5K | |
