![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 06 First Reaction (v2).m4a | 2017-06-30 15:22 | 14M | |
| 07 Controlling the House Pt2.m4a | 2017-06-30 15:22 | 13M | |
| 03 Barbiturik Blues.m4a | 2017-06-30 15:22 | 13M | |
| 09 Jeux d'enfants.m4a | 2017-06-30 15:22 | 12M | |
| 02 9,01-9_06.m4a | 2017-06-30 15:22 | 12M | |
| 08 (I Wanna Be) Waiting for My Plane.m4a | 2017-06-30 15:22 | 11M | |
| 05 Act 1 Minotaure Ex,.m4a | 2017-06-30 15:22 | 10M | |
| 01 The Cloud Making Machine Pt1.m4a | 2017-06-30 15:22 | 9.8M | |
| 04 Huis Clos.m4a | 2017-06-30 15:22 | 9.6M | |
| 10 The Cloud Making Machine Pt2.m4a | 2017-06-30 15:22 | 5.0M | |