![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Mozart - Symphonie 40 & 41/ | 2026-08-06 11:20 | - | |
| Mozart - Requiem K626/ | 2026-08-06 11:19 | - | |
| Bach 50 Solos - Klassieke Gitaar/ | 2026-06-26 10:30 | - | |
| Monster Magnet/ | 2026-01-07 08:54 | - | |
| _gsdata_/ | 2026-01-07 08:54 | - | |
| Smashing Pumpkins/ | 2025-08-30 18:30 | - | |
| Pizzicato Five/ | 2025-08-30 18:30 | - | |
| Ashbury Faith/ | 2024-09-04 10:16 | - | |
| Dorothee Mields & Boreas Quartett Bremen/ | 2024-09-04 10:15 | - | |
| Zita Swoon/ | 2024-06-13 14:52 | - | |
| Yasmine/ | 2024-06-13 14:50 | - | |
| Woody Smalls/ | 2024-06-13 14:50 | - | |
| Wolfgang Amadeus Mozart/ | 2024-06-13 14:50 | - | |
| Wigbert/ | 2024-06-13 14:46 | - | |
| Will Tura/ | 2024-06-13 14:46 | - | |
| Will Tura & Christoff/ | 2024-06-13 14:46 | - | |
| White Zombie/ | 2024-06-13 14:46 | - | |
| Wagner- The Ride of the Valkyries; Overtures and Choruses/ | 2024-06-13 14:46 | - | |
| Whitney Houston/ | 2024-06-13 14:46 | - | |
| Vengaboys/ | 2024-06-13 14:45 | - | |
| Variationen/ | 2024-06-13 14:44 | - | |
| Underworld/ | 2024-06-13 14:43 | - | |
| Triggerfinger/ | 2024-06-13 14:39 | - | |
| Urban Dance Squad/ | 2024-06-13 14:39 | - | |
| U2/ | 2024-06-13 14:38 | - | |
| Tricky/ | 2024-06-13 14:35 | - | |
| Touch and Go/ | 2024-06-13 14:35 | - | |
| Tracy Bonham/ | 2024-06-13 14:35 | - | |
| Tiga/ | 2024-06-13 14:35 | - | |
| TLC/ | 2024-06-13 14:35 | - | |
| Thelonious Monk/ | 2024-06-13 14:32 | - | |
| Therapy-/ | 2024-06-13 14:29 | - | |
| The Sugarcubes/ | 2024-06-13 14:27 | - | |
| The Subs/ | 2024-06-13 14:27 | - | |
| The Smashing Pumpkins/ | 2024-06-13 14:26 | - | |
| The Prodigy/ | 2024-06-13 14:23 | - | |
| The Sex Pistols/ | 2024-06-13 14:23 | - | |
| The Red Hot Chili Peppers/ | 2024-06-13 14:19 | - | |
| The Chemical Brothers/ | 2024-06-13 14:16 | - | |
| The end is the beginning is the end/ | 2024-06-13 14:14 | - | |
| The Best of Snoop Dogg/ | 2024-06-13 14:11 | - | |
| The Black Crowes/ | 2024-06-13 14:06 | - | |
| Tchaikovsky/ | 2024-06-13 14:06 | - | |
| Temple of the Dog/ | 2024-06-13 14:03 | - | |
| TaxiWars/ | 2024-06-13 14:01 | - | |
| Sven Van Hees/ | 2024-06-13 14:01 | - | |
| Symphony No.40 in G minor, KV 550/ | 2024-06-13 14:00 | - | |
| Supergrass/ | 2024-06-13 13:58 | - | |
| Starflam/ | 2024-06-13 13:57 | - | |
| Sugarhill Remixes/ | 2024-06-13 13:56 | - | |
| Stone Temple Pilots/ | 2024-06-13 13:56 | - | |
| stijn/ | 2024-06-13 13:55 | - | |
| Stardust/ | 2024-06-13 13:54 | - | |
| Spin Doctors/ | 2024-06-13 13:54 | - | |
| Soulwax/ | 2024-06-13 13:52 | - | |
| Spice Girls/ | 2024-06-13 13:52 | - | |
| Soundgarden/ | 2024-06-13 13:50 | - | |
| Snoop Dogg/ | 2024-06-13 13:47 | - | |
| Skunk Anansie/ | 2024-06-13 13:47 | - | |
| Slongs die van ons/ | 2024-06-13 13:44 | - | |
| Sint Andries MC´s/ | 2024-06-13 13:42 | - | |
| Silicone Soul/ | 2024-06-13 13:42 | - | |
| Senser/ | 2024-06-13 13:42 | - | |
| Röyksopp/ | 2024-06-13 13:42 | - | |
| Royal Blood/ | 2024-06-13 13:41 | - | |
| Roni Size/ | 2024-06-13 13:40 | - | |
| Rossini ouvertures/ | 2024-06-13 13:39 | - | |
| Roni Size-Reprazent/ | 2024-06-13 13:39 | - | |
| Roni Size & Reprazent/ | 2024-06-13 13:37 | - | |
| Roni Size & DJ Krust/ | 2024-06-13 13:36 | - | |
| Rollins Band/ | 2024-06-13 13:34 | - | |
| rive featuring danni minogue/ | 2024-06-13 13:34 | - | |
| Raymond/ | 2024-06-13 13:33 | - | |
| Republica/ | 2024-06-13 13:33 | - | |
| Reef/ | 2024-06-13 13:33 | - | |
| Rage Against the Machine/ | 2024-06-13 13:30 | - | |
| Push Universal Nation/ | 2024-06-13 13:27 | - | |
| Queens of the Stone Age/ | 2024-06-13 13:26 | - | |
| Queen/ | 2024-06-13 13:26 | - | |
| Prager Symphonie/ | 2024-06-13 13:26 | - | |
| Prophets of Rage/ | 2024-06-13 13:26 | - | |
| Presidents of the United States of America/ | 2024-06-13 13:26 | - | |
| Praga Khan/ | 2024-06-13 13:23 | - | |
| Placebo/ | 2024-06-13 13:23 | - | |
| Portishead/ | 2024-06-13 13:19 | - | |
| Phats & Small/ | 2024-06-13 13:16 | - | |
| PC/ | 2024-06-13 13:16 | - | |
| Pete Heller'S/ | 2024-06-13 13:16 | - | |
| Pariser Symphonie/ | 2024-06-13 13:12 | - | |
| Pearl Jam/ | 2024-06-13 13:12 | - | |
| Paul Weller/ | 2024-06-13 13:12 | - | |
| Orbital/ | 2024-06-13 13:04 | - | |
| Paganinni - Luigi Attademo/ | 2024-06-13 13:03 | - | |
| Oasis/ | 2024-06-13 13:00 | - | |
| Onbekende artiest/ | 2024-06-13 12:59 | - | |
| Nirvana/ | 2024-06-13 12:56 | - | |
| Nikolaus Harnoncourt/ | 2024-06-13 12:56 | - | |
| Nicolette/ | 2024-06-13 12:55 | - | |
| Natalia/ | 2024-06-13 12:53 | - | |
| Netsky/ | 2024-06-13 12:53 | - | |
| Nelly/ | 2024-06-13 12:53 | - | |
| neder wiede wiede wiet/ | 2024-06-13 12:53 | - | |
| Nancy Sinatra/ | 2024-06-13 12:52 | - | |
| Mussorgsky/ | 2024-06-13 12:52 | - | |
| Mozart Variaties/ | 2024-06-13 12:51 | - | |
| Mr. Oizo/ | 2024-06-13 12:50 | - | |
| Mozart Piano Sonates/ | 2024-06-13 12:49 | - | |
| Mozart strijk trios/ | 2024-06-13 12:48 | - | |
| Mozart strijkkwartetten/ | 2024-06-13 12:44 | - | |
| Morphine/ | 2024-06-13 12:40 | - | |
| Moondog Jr/ | 2024-06-13 12:40 | - | |
| MonteVerdi/ | 2024-06-13 12:39 | - | |
| Modjo/ | 2024-06-13 12:36 | - | |
| Mitradate Atto trei/ | 2024-06-13 12:36 | - | |
| Moloko/ | 2024-06-13 12:36 | - | |
| Moby/ | 2024-06-13 12:36 | - | |
| Mithradate Atto 1/ | 2024-06-13 12:34 | - | |
| Mitradate atto 2/ | 2024-06-13 12:33 | - | |
| Missae Breves II/ | 2024-06-13 12:31 | - | |
| Missae Breves I/ | 2024-06-13 12:31 | - | |
| Miles Davis/ | 2024-06-13 12:30 | - | |
| Millionaire/ | 2024-06-13 12:28 | - | |
| Michael Jackson/ | 2024-06-13 12:25 | - | |
| Michael Brecker Quindectet/ | 2024-06-13 12:24 | - | |
| Metallica/ | 2024-06-13 12:23 | - | |
| MC Solaar/ | 2024-06-13 12:23 | - | |
| Metalheadz/ | 2024-06-13 12:20 | - | |
| Massive Attack/ | 2024-06-13 12:19 | - | |
| Mathieu & Guillaume/ | 2024-06-13 12:17 | - | |
| Marilena/ | 2024-06-13 12:16 | - | |
| Magnus/ | 2024-06-13 12:16 | - | |
| Madonna/ | 2024-06-13 12:14 | - | |
| Lully/ | 2024-06-13 12:14 | - | |
| Lucia Sillo/ | 2024-06-13 12:07 | - | |
| Louis Sclavis Quartet/ | 2024-06-13 12:03 | - | |
| Lordz of Brooklyn/ | 2024-06-13 12:03 | - | |
| LL Cool J feat Jennifer Lopez/ | 2024-06-13 12:03 | - | |
| Lisa Stansfield/ | 2024-06-13 12:02 | - | |
| Limp Bizkit2/ | 2024-06-13 12:02 | - | |
| LL Cool J/ | 2024-06-13 12:02 | - | |
| Linzer Symphonie/ | 2024-06-13 12:02 | - | |
| Limp Bizkit/ | 2024-06-13 11:59 | - | |
| Lenny Kravitz/ | 2024-06-13 11:59 | - | |
| Le Nozze di Figaro Atto III/ | 2024-06-13 11:56 | - | |
| Leonard Bernstein/ | 2024-06-13 11:56 | - | |
| Le Nozze di Figaro IV/ | 2024-06-13 11:55 | - | |
| Le Nozze di Figaro Atto I/ | 2024-06-13 11:55 | - | |
| Le Nozze di Figaro Atto II/ | 2024-06-13 11:55 | - | |
| Le Nozze di Figaro/ | 2024-06-13 11:54 | - | |
| Lais/ | 2024-06-13 11:51 | - | |
| Lauryn Hill/ | 2024-06-13 11:51 | - | |
| Laurent Garnier/ | 2024-06-13 11:49 | - | |
| La Clemenzia di Tito/ | 2024-06-13 11:47 | - | |
| Kylie Minogue/ | 2024-06-13 11:47 | - | |
| Kula Shaker/ | 2024-06-13 11:47 | - | |
| Ken Ishii/ | 2024-06-13 11:45 | - | |
| Kate Ryan/ | 2024-06-13 11:44 | - | |
| Khaled/ | 2024-06-13 11:44 | - | |
| Kelis/ | 2024-06-13 11:43 | - | |
| K.I.A/ | 2024-06-13 11:42 | - | |
| Just Estelle/ | 2024-06-13 11:41 | - | |
| Jupiter-Symphonie/ | 2024-06-13 11:41 | - | |
| Josef Myslivecek/ | 2024-06-13 11:41 | - | |
| Jon Spencer Blues Explosion/ | 2024-06-13 11:39 | - | |
| Jos Van Immerseel_Anima eterna/ | 2024-06-13 11:37 | - | |
| Johann Sebastian Bach/ | 2024-06-13 11:36 | - | |
| Jimi Hendrix/ | 2024-06-13 11:36 | - | |
| Johan Verminnen/ | 2024-06-13 11:34 | - | |
| Jamiroquai/ | 2024-06-13 11:34 | - | |
| Jeff Buckley/ | 2024-06-13 11:32 | - | |
| James Brown/ | 2024-06-13 11:31 | - | |
| J.S. Bach- Toccata & Fugue BWV 565, etc/ | 2024-06-13 11:25 | - | |
| James Brown And His Famous Flames/ | 2024-06-13 11:25 | - | |
| J Strauss II/ | 2024-06-13 11:24 | - | |
| J.S.Bach - Orchestral Suites/ | 2024-06-13 11:22 | - | |
| Idomeneo, re di creta/ | 2024-06-13 11:22 | - | |
| Haydn/ | 2024-06-13 11:17 | - | |
| Hooverphonic/ | 2024-06-13 11:17 | - | |
| Hole/ | 2024-06-13 11:17 | - | |
| HAYDN FJ Pescatrici (Le) (Opera) (Geczy)/ | 2024-06-13 11:14 | - | |
| Gloria Estefan/ | 2024-06-13 11:13 | - | |
| Grand Master Flash/ | 2024-06-13 11:13 | - | |
| Gershwin/ | 2024-06-13 11:12 | - | |
| Goldie/ | 2024-06-13 11:11 | - | |
| giovanotti/ | 2024-06-13 11:11 | - | |
| Garbage/ | 2024-06-13 11:10 | - | |
| Fun Lovin' Criminals/ | 2024-06-13 11:09 | - | |
| Funk d'Void/ | 2024-06-13 11:08 | - | |
| Galliano/ | 2024-06-13 11:06 | - | |
| Full Cycle/ | 2024-06-13 11:04 | - | |
| Foo Fighters/ | 2024-06-13 11:04 | - | |
| Exultate Jubilate/ | 2024-06-13 11:01 | - | |
| Frank Sinatra/ | 2024-06-13 11:01 | - | |
| Fedde Legrand/ | 2024-06-13 11:01 | - | |
| Extince/ | 2024-06-13 10:58 | - | |
| Eric Dolphy/ | 2024-06-13 10:58 | - | |
| Evil Superstars/ | 2024-06-13 10:57 | - | |
| Elvis Presley/ | 2024-06-13 10:57 | - | |
| Eine Kleine Nachtmusik/ | 2024-06-13 10:56 | - | |
| Dr. Dre/ | 2024-06-13 10:56 | - | |
| Don Giovanni Atto I/ | 2024-06-13 10:56 | - | |
| Don Giovanni Atto II/ | 2024-06-13 10:55 | - | |
| DJ Sets/ | 2024-06-13 10:50 | - | |
| Dizzee Rascal/ | 2024-06-13 10:48 | - | |
| Digitalism/ | 2024-06-13 10:47 | - | |
| Diverse artiesten/ | 2024-06-13 10:46 | - | |
| dEUS/ | 2024-06-13 10:46 | - | |
| Die Zauberflöte/ | 2024-06-13 10:43 | - | |
| Deee-Lite/ | 2024-06-13 10:39 | - | |
| Dead Man Ray/ | 2024-06-13 10:39 | - | |
| David Bowie/ | 2024-06-13 10:37 | - | |
| De La Soul/ | 2024-06-13 10:34 | - | |
| Daft Punk/ | 2024-06-13 10:33 | - | |
| Cypress Hill/ | 2024-06-13 10:31 | - | |
| Daan/ | 2024-06-13 10:29 | - | |
| Cosi fan tutte Atto II/ | 2024-06-13 10:28 | - | |
| CPeX/ | 2024-06-13 10:27 | - | |
| Cosi fan tutte Atto I/ | 2024-06-13 10:27 | - | |
| Concierto de Aranjuez/ | 2024-06-13 10:26 | - | |
| Claudio Abbado/ | 2024-06-13 10:25 | - | |
| Collegium Vocale Gent, Hanno Müller-Brac/ | 2024-06-13 10:22 | - | |
| Clarinet Quintet Wolfgang Amadeus Mozart/ | 2024-06-13 10:21 | - | |
| Clarinet Concerto/ | 2024-06-13 10:21 | - | |
| Cher Believe/ | 2024-06-13 10:20 | - | |
| Chucho Swing/ | 2024-06-13 10:20 | - | |
| Charles Ives/ | 2024-06-13 10:18 | - | |
| Channel Zero/ | 2024-06-13 10:18 | - | |
| Cassius/ | 2024-06-13 10:18 | - | |
| Carl Cox/ | 2024-06-13 10:16 | - | |
| Carl Maria von Weber/ | 2024-06-13 10:16 | - | |
| Café d'anvers 15 years/ | 2024-06-13 10:14 | - | |
| Café d'Anvers/ | 2024-06-13 10:13 | - | |
| Bush/ | 2024-06-13 10:11 | - | |
| Byron Schenkman - Bach - Harpischord/ | 2024-06-13 10:11 | - | |
| Britney Spears/ | 2024-06-13 10:09 | - | |
| Brandenburger Concerti/ | 2024-06-13 10:09 | - | |
| Brahms Clarinet concerto opus 115/ | 2024-06-13 10:08 | - | |
| Brainpower/ | 2024-06-13 10:08 | - | |
| Bonzai/ | 2024-06-13 10:08 | - | |
| Bones/ | 2024-06-13 10:07 | - | |
| Boesmans - Pinocchio/ | 2024-06-13 10:06 | - | |
| Body Count/ | 2024-06-13 10:02 | - | |
| Bob Marley/ | 2024-06-13 10:02 | - | |
| Bodyrox/ | 2024-06-13 10:02 | - | |
| Bob Sinclar/ | 2024-06-13 10:01 | - | |
| Blur/ | 2024-06-13 09:57 | - | |
| Björk/ | 2024-06-13 09:54 | - | |
| Bernstein_ West Side Story_ The Original/ | 2024-06-13 09:49 | - | |
| Billy Corgan/ | 2024-06-13 09:49 | - | |
| Benno Moiseiwitsch/ | 2024-06-13 09:47 | - | |
| Belly Dance/ | 2024-06-13 09:45 | - | |
| Beck/ | 2024-06-13 09:45 | - | |
| Belly/ | 2024-06-13 09:43 | - | |
| Basement Jaxx/ | 2024-06-13 09:42 | - | |
| Beastie Boys/ | 2024-06-13 09:38 | - | |
| BACH JS Cantatas (Herreweghe) - BWV 57 110 122 (Ca/ | 2024-06-13 09:32 | - | |
| Bartok/ | 2024-06-13 09:32 | - | |
| BART KAëLL/ | 2024-06-13 09:32 | - | |
| Baroque guitar concertos/ | 2024-06-13 09:32 | - | |
| Band of Skulls/ | 2024-06-13 09:31 | - | |
| B52s/ | 2024-06-13 09:29 | - | |
| Atari Teenage Riot/ | 2024-06-13 09:29 | - | |
| Anime Immortali - Mozart Arias/ | 2024-06-13 09:28 | - | |
| Axelle Red/ | 2024-06-13 09:28 | - | |
| Amy Winehouse/ | 2024-06-13 09:26 | - | |
| A Meeting Place - Medieval & Renaissance Music fo/ | 2024-06-13 09:25 | - | |
| Alice in Chains/ | 2024-06-13 09:25 | - | |
| Alanis Morissette/ | 2024-06-13 09:25 | - | |
| Air/ | 2024-06-13 09:23 | - | |
| 'tHof van Commerce/ | 2024-06-13 09:23 | - | |